Diethylenglykol-monobutylether (Butyldiglykol) 99 %, 1,0 l

Naturprodukte und Feinchemikalien

Frau Dr. Birgit Henrichfreise
Zum Sporkfeld 48
DE - 33397 Rietberg
Telefon: 05244-9391039
Telefax: 05244-700955
E-Mail :

USt-ID-Nummer: DE217152352

Steuernummer FA Rheda-Wiedenbrück:
347 5945 0892


Synonyme: 2-(2-Butoxyethoxy)ethanol, Butyldiglycol;
engl. 2-(2-Butoxyethoxy)ethanol, Butyl CARBITOLŪ, Butyldiglycol *
Molecular Formula: CH3(CH2)3OCH2CH2OCH2CH2OH * CAS-No.[112-34-5] * Molmasse/F.W.: 162,23 g/mol * BRN: 1739225 * RTECS# KJ9100000 *
Gehalt/assay: ~99% * Kp./b.p.: ~231 °C * Brechungsindex = 1,4320 * D = 0,967 * Fp: 99 °C *
Gefahrstoff gem. GefStoffV (D): ja, Xi - REIZEND * Schweizer Giftklasse: CH Frei *

42,00 inkl. MwSt.



Stand: 2018-10-29 10:54:34