Linalylacetat (Essigsäurelinalylester) 10 ml
ARTIKELNUMMER: 101414-10

OMIKRON
Naturprodukte und Feinchemikalien


Frau Dr. Birgit Henrichfreise
Zum Sporkfeld 48
DE - 33397 Rietberg
Telefon: 05244-9391039
Telefax: 05244-700955
E-Mail : office@omikron-online.de

USt-ID-Nummer: DE217152352

Steuernummer FA Rheda-Wiedenbrück:
347 5945 0892

www.omikron-online.de

BESCHREIBUNG:


Synonyme: Essigsäure-linalylester; engl. Linalyl acetate, Acetic acid linalyl ester; 3,7-Dimethyl-1,6-octadien-3-yl acetate *
Chem. Formel/Molecular Formula:
CH3CO2C(CH=CH2)(CH3)CH2CH2CH=C(CH3)2 *
Molmasse/Molecular Weight: 196.29 g/mol *
IDENTIFIKATIONSNUMMERN....
CAS Number [115-95-7] * FEMA Number: 2636 * Beilstein Registry Number: 1724500 * EG/EC-Number: 204-116-4 (EINECS) * Council of Europe no. 0203 * MDL number: MFCD00008907 *
EIGENSCHAFTEN....
Dampfdichte/vapor density: 6.8 (vs air);
Dampfdruck/vapor pressure: 0.1 mmHg (20 °C);
Brechungsindex/refractive index n20/D: 1.453 (lit.);
Siedepunkt/b.p.: 220 °C (lit.);
Fp: 194 °F;
Dichte/density (25 °C): 0.901 g/mL (lit.);
Literaturhinweise: Merck Index 13, 5518; Beil. 2,IV,205; Arctander, 1806; Fenaroli, 433; Sax 6, 1184 #115957


PREIS:
2,95 inkl. MwSt.

PRODUKT-LINK: https://www.omikron-online.de/index.php?product=101414-10&lang=1



> KAUFEN

ZURÜCK ZUM PRODUKTKATALOG ::: KATALOG ALS PDF
Stand: 2018-06-29 13:18:53